C11H12FNO3 — CID 25058582
(2S,4R)-4-fluoro-2-(4-nitrophenyl)oxane (PubChem CID 25058582) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is (2S,4R)-4-fluoro-2-(4-nitrophenyl)oxane.
| Compound Name | (2S,4R)-4-fluoro-2-(4-nitrophenyl)oxane |
|---|---|
| PubChem CID | 25058582 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2S,4R)-4-fluoro-2-(4-nitrophenyl)oxane |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2C[C@H](F)CCO2)cc1 |
| InChI | InChI=1S/C11H12FNO3/c12-9-5-6-16-11(7-9)8-1-3-10(4-2-8)13(14)15/h1-4,9,11H,5-7H2/t9-,11+/m1/s1 |
| InChIKey | CWANVDBCCCVACM-KOLCDFICSA-N |
| XLogP | 2.78 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|