C18H19N3O4 — CID 99829011
2-amino-5-nitro-N-[(2R,4R)-2-phenyloxan-4-yl]benzamide (PubChem CID 99829011) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-amino-5-nitro-N-[(2R,4R)-2-phenyloxan-4-yl]benzamide.
| Compound Name | 2-amino-5-nitro-N-[(2R,4R)-2-phenyloxan-4-yl]benzamide |
|---|---|
| PubChem CID | 99829011 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-amino-5-nitro-N-[(2R,4R)-2-phenyloxan-4-yl]benzamide |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C(=O)N[C@@H]1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H19N3O4/c19-16-7-6-14(21(23)24)11-15(16)18(22)20-13-8-9-25-17(10-13)12-4-2-1-3-5-12/h1-7,11,13,17H,8-10,19H2,(H,20,22)/t13-,17-/m1/s1 |
| InChIKey | PWQMYUSQNLRHOR-CXAGYDPISA-N |
| XLogP | 2.83 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|