C19H15F3NNaO4 — CID 167779269
sodium 4,5-difluoro-2-[[2-(4-fluorophenyl)oxan-4-yl]carbamoyl]benzoate (PubChem CID 167779269) has the molecular formula C19H15F3NNaO4 and a molecular weight of 401.32 g/mol. Its IUPAC name is sodium 4,5-difluoro-2-[[2-(4-fluorophenyl)oxan-4-yl]carbamoyl]benzoate.
| Compound Name | sodium 4,5-difluoro-2-[[2-(4-fluorophenyl)oxan-4-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 167779269 |
| Molecular Formula | C19H15F3NNaO4 |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | sodium 4,5-difluoro-2-[[2-(4-fluorophenyl)oxan-4-yl]carbamoyl]benzoate |
| SMILES | O=C([O-])c1cc(F)c(F)cc1C(=O)NC1CCOC(c2ccc(F)cc2)C1.[Na+] |
| InChI | InChI=1S/C19H16F3NO4.Na/c20-11-3-1-10(2-4-11)17-7-12(5-6-27-17)23-18(24)13-8-15(21)16(22)9-14(13)19(25)26;/h1-4,8-9,12,17H,5-7H2,(H,23,24)(H,25,26);/q;+1/p-1 |
| InChIKey | KPDDLXILKIQOHT-UHFFFAOYSA-M |
| XLogP | -0.88 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |