About N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide
N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide (PubChem CID 97353433) has the molecular formula C22H21FN2O2
and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide.
Molecular Properties
| Compound Name | N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide |
| PubChem CID | 97353433 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide |
| SMILES | O=C(N[C@@H]1CCO[C@H](c2ccc(F)cc2)C1)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C22H21FN2O2/c23-18-8-6-16(7-9-18)21-15-19(10-13-27-21)24-22(26)17-4-3-5-20(14-17)25-11-1-2-12-25/h1-9,11-12,14,19,21H,10,13,15H2,(H,24,26)/t19-,21+/m1/s1 |
| InChIKey | MANFIIOCWHNJAM-CTNGQTDRSA-N |
| XLogP | 4.27 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide?
The IUPAC name of N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide (CID 97353433) is N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide.
What is the SMILES notation for N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide?
The canonical SMILES for N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide is O=C(N[C@@H]1CCO[C@H](c2ccc(F)cc2)C1)c1cccc(-n2cccc2)c1.
What is the InChIKey of N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide?
The InChIKey is MANFIIOCWHNJAM-CTNGQTDRSA-N. The full InChI is InChI=1S/C22H21FN2O2/c23-18-8-6-16(7-9-18)21-15-19(10-13-27-21)24-22(26)17-4-3-5-20(14-17)25-11-1-2-12-25/h1-9,11-12,14,19,21H,10,13,15H2,(H,24,26)/t19-,21+/m1/s1.
What are the key properties of N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide?
N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide has a molecular weight of 364.42 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,4R)-2-(4-fluorophenyl)oxan-4-yl]-3-pyrrol-1-ylbenzamide is sourced from PubChem (CID 97353433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).