C20H23FN2O2 — CID 99717246
1-[2-(3-fluorophenyl)ethyl]-3-[(2R,4R)-2-phenyloxan-4-yl]urea (PubChem CID 99717246) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-3-[(2R,4R)-2-phenyloxan-4-yl]urea.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-3-[(2R,4R)-2-phenyloxan-4-yl]urea |
|---|---|
| PubChem CID | 99717246 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-3-[(2R,4R)-2-phenyloxan-4-yl]urea |
| SMILES | O=C(NCCc1cccc(F)c1)N[C@@H]1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H23FN2O2/c21-17-8-4-5-15(13-17)9-11-22-20(24)23-18-10-12-25-19(14-18)16-6-2-1-3-7-16/h1-8,13,18-19H,9-12,14H2,(H2,22,23,24)/t18-,19-/m1/s1 |
| InChIKey | VMXSZGUJEUGFNL-RTBURBONSA-N |
| XLogP | 3.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |