C11H13FN2O — CID 47171959
1-cyclopropyl-3-[(3-fluorophenyl)methyl]urea (PubChem CID 47171959) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(3-fluorophenyl)methyl]urea.
| Compound Name | 1-cyclopropyl-3-[(3-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 47171959 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-cyclopropyl-3-[(3-fluorophenyl)methyl]urea |
| SMILES | O=C(NCc1cccc(F)c1)NC1CC1 |
| InChI | InChI=1S/C11H13FN2O/c12-9-3-1-2-8(6-9)7-13-11(15)14-10-4-5-10/h1-3,6,10H,4-5,7H2,(H2,13,14,15) |
| InChIKey | LHTZYVZKESKHEG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |