C13H17FN2O3 — CID 91768630
1-[(3-fluorophenyl)methyl]-3-[(3S,4R)-3-hydroxyoxan-4-yl]urea (PubChem CID 91768630) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-[(3S,4R)-3-hydroxyoxan-4-yl]urea.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-[(3S,4R)-3-hydroxyoxan-4-yl]urea |
|---|---|
| PubChem CID | 91768630 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-[(3S,4R)-3-hydroxyoxan-4-yl]urea |
| SMILES | O=C(NCc1cccc(F)c1)N[C@@H]1CCOC[C@H]1O |
| InChI | InChI=1S/C13H17FN2O3/c14-10-3-1-2-9(6-10)7-15-13(18)16-11-4-5-19-8-12(11)17/h1-3,6,11-12,17H,4-5,7-8H2,(H2,15,16,18)/t11-,12-/m1/s1 |
| InChIKey | OFBMAQCRMHYTNO-VXGBXAGGSA-N |
| XLogP | 0.77 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |