C15H21FN2O3 — CID 91774796
1-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-3-propylurea (PubChem CID 91774796) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is 1-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-3-propylurea.
| Compound Name | 1-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-3-propylurea |
|---|---|
| PubChem CID | 91774796 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-3-propylurea |
| SMILES | CCCNC(=O)N[C@@H]1COCC[C@@H]1Oc1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN2O3/c1-2-7-17-15(19)18-13-10-20-8-6-14(13)21-12-5-3-4-11(16)9-12/h3-5,9,13-14H,2,6-8,10H2,1H3,(H2,17,18,19)/t13-,14+/m1/s1 |
| InChIKey | KTEDTAKNHISNGB-KGLIPLIRSA-N |
| XLogP | 2.07 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |