C17H24FNO3 — CID 91792235
2-ethyl-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]butanamide (PubChem CID 91792235) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-ethyl-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]butanamide.
| Compound Name | 2-ethyl-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]butanamide |
|---|---|
| PubChem CID | 91792235 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-ethyl-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]butanamide |
| SMILES | CCC(CC)C(=O)N[C@@H]1COCC[C@@H]1Oc1cccc(F)c1 |
| InChI | InChI=1S/C17H24FNO3/c1-3-12(4-2)17(20)19-15-11-21-9-8-16(15)22-14-7-5-6-13(18)10-14/h5-7,10,12,15-16H,3-4,8-9,11H2,1-2H3,(H,19,20)/t15-,16+/m1/s1 |
| InChIKey | JWSBAWSOJZJWBQ-CVEARBPZSA-N |
| XLogP | 2.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |