C15H20FNO4 — CID 156609137
2-ethoxy-N-[4-(3-fluorophenoxy)oxan-3-yl]acetamide (PubChem CID 156609137) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-ethoxy-N-[4-(3-fluorophenoxy)oxan-3-yl]acetamide.
| Compound Name | 2-ethoxy-N-[4-(3-fluorophenoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 156609137 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-ethoxy-N-[4-(3-fluorophenoxy)oxan-3-yl]acetamide |
| SMILES | CCOCC(=O)NC1COCCC1Oc1cccc(F)c1 |
| InChI | InChI=1S/C15H20FNO4/c1-2-19-10-15(18)17-13-9-20-7-6-14(13)21-12-5-3-4-11(16)8-12/h3-5,8,13-14H,2,6-7,9-10H2,1H3,(H,17,18) |
| InChIKey | YSNSIUQZJJQSFR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |