C19H27FN2O4 — CID 91779628
N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-4-morpholin-4-ylbutanamide (PubChem CID 91779628) has the molecular formula C19H27FN2O4 and a molecular weight of 366.43 g/mol. Its IUPAC name is N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-4-morpholin-4-ylbutanamide.
| Compound Name | N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-4-morpholin-4-ylbutanamide |
|---|---|
| PubChem CID | 91779628 |
| Molecular Formula | C19H27FN2O4 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-4-morpholin-4-ylbutanamide |
| SMILES | O=C(CCCN1CCOCC1)N[C@@H]1COCC[C@@H]1Oc1cccc(F)c1 |
| InChI | InChI=1S/C19H27FN2O4/c20-15-3-1-4-16(13-15)26-18-6-10-25-14-17(18)21-19(23)5-2-7-22-8-11-24-12-9-22/h1,3-4,13,17-18H,2,5-12,14H2,(H,21,23)/t17-,18+/m1/s1 |
| InChIKey | ONITXSXAGZGKQK-MSOLQXFVSA-N |
| XLogP | 1.59 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |