C19H25FN2O4 — CID 156609816
N-[3-(3-fluorophenoxy)oxan-4-yl]-4-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 156609816) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[3-(3-fluorophenoxy)oxan-4-yl]-4-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | N-[3-(3-fluorophenoxy)oxan-4-yl]-4-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 156609816 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[3-(3-fluorophenoxy)oxan-4-yl]-4-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | O=C(CCCN1CCCC1=O)NC1CCOCC1Oc1cccc(F)c1 |
| InChI | InChI=1S/C19H25FN2O4/c20-14-4-1-5-15(12-14)26-17-13-25-11-8-16(17)21-18(23)6-2-9-22-10-3-7-19(22)24/h1,4-5,12,16-17H,2-3,6-11,13H2,(H,21,23) |
| InChIKey | GPFCEGHMBOQFQW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |