C20H28N2O4 — CID 91793611
3-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide (PubChem CID 91793611) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 3-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide.
| Compound Name | 3-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide |
|---|---|
| PubChem CID | 91793611 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 3-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide |
| SMILES | O=C(CCN1CCCCC1=O)N[C@@H]1CCOC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H28N2O4/c23-19(9-12-22-11-5-4-8-20(22)24)21-17-10-13-25-15-18(17)26-14-16-6-2-1-3-7-16/h1-3,6-7,17-18H,4-5,8-15H2,(H,21,23)/t17-,18-/m1/s1 |
| InChIKey | IYTQJGLDLBXIEI-QZTJIDSGSA-N |
| XLogP | 1.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |