C19H29N3O3 — CID 133268380
N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-4-pyrazolidin-4-ylbutanamide (PubChem CID 133268380) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-4-pyrazolidin-4-ylbutanamide.
| Compound Name | N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-4-pyrazolidin-4-ylbutanamide |
|---|---|
| PubChem CID | 133268380 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-4-pyrazolidin-4-ylbutanamide |
| SMILES | O=C(CCCC1CNNC1)N[C@@H]1CCOC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H29N3O3/c23-19(8-4-7-16-11-20-21-12-16)22-17-9-10-24-14-18(17)25-13-15-5-2-1-3-6-15/h1-3,5-6,16-18,20-21H,4,7-14H2,(H,22,23)/t17-,18-/m1/s1 |
| InChIKey | YKOBTEZYDGOVGY-QZTJIDSGSA-N |
| XLogP | 1.37 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |