C16H18FN3O5 — CID 90653248
2-(2,5-dioxoimidazolidin-1-yl)-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]acetamide (PubChem CID 90653248) has the molecular formula C16H18FN3O5 and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 90653248 |
| Molecular Formula | C16H18FN3O5 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)CNC1=O)N[C@@H]1COCC[C@@H]1Oc1cccc(F)c1 |
| InChI | InChI=1S/C16H18FN3O5/c17-10-2-1-3-11(6-10)25-13-4-5-24-9-12(13)19-14(21)8-20-15(22)7-18-16(20)23/h1-3,6,12-13H,4-5,7-9H2,(H,18,23)(H,19,21)/t12-,13+/m1/s1 |
| InChIKey | GHHJMNYHCPVPRK-OLZOCXBDSA-N |
| XLogP | 0.03 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|