C18H24FNO4 — CID 91761705
N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-2-(3-fluorophenoxy)acetamide (PubChem CID 91761705) has the molecular formula C18H24FNO4 and a molecular weight of 337.39 g/mol. Its IUPAC name is N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-2-(3-fluorophenoxy)acetamide.
| Compound Name | N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-2-(3-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 91761705 |
| Molecular Formula | C18H24FNO4 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-2-(3-fluorophenoxy)acetamide |
| SMILES | O=C(COc1cccc(F)c1)N[C@@H]1COCC[C@@H]1OCC1CCC1 |
| InChI | InChI=1S/C18H24FNO4/c19-14-5-2-6-15(9-14)23-12-18(21)20-16-11-22-8-7-17(16)24-10-13-3-1-4-13/h2,5-6,9,13,16-17H,1,3-4,7-8,10-12H2,(H,20,21)/t16-,17+/m1/s1 |
| InChIKey | HXMPYINXINQEDX-SJORKVTESA-N |
| XLogP | 2.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |