C15H17Cl2NO6 — CID 91771663
2-[(3R,4S)-3-[[2-(3,4-dichlorophenoxy)acetyl]amino]oxan-4-yl]oxyacetic acid (PubChem CID 91771663) has the molecular formula C15H17Cl2NO6 and a molecular weight of 378.21 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[[2-(3,4-dichlorophenoxy)acetyl]amino]oxan-4-yl]oxyacetic acid.
| Compound Name | 2-[(3R,4S)-3-[[2-(3,4-dichlorophenoxy)acetyl]amino]oxan-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 91771663 |
| Molecular Formula | C15H17Cl2NO6 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 2-[(3R,4S)-3-[[2-(3,4-dichlorophenoxy)acetyl]amino]oxan-4-yl]oxyacetic acid |
| SMILES | O=C(O)CO[C@H]1CCOC[C@H]1NC(=O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H17Cl2NO6/c16-10-2-1-9(5-11(10)17)23-7-14(19)18-12-6-22-4-3-13(12)24-8-15(20)21/h1-2,5,12-13H,3-4,6-8H2,(H,18,19)(H,20,21)/t12-,13+/m1/s1 |
| InChIKey | DVUSEWKXUFKPSY-OLZOCXBDSA-N |
| XLogP | 1.75 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |