C15H21NO5S — CID 91794268
2-[(3R,4S)-3-(4-thiophen-2-ylbutanoylamino)oxan-4-yl]oxyacetic acid (PubChem CID 91794268) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is 2-[(3R,4S)-3-(4-thiophen-2-ylbutanoylamino)oxan-4-yl]oxyacetic acid.
| Compound Name | 2-[(3R,4S)-3-(4-thiophen-2-ylbutanoylamino)oxan-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 91794268 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[(3R,4S)-3-(4-thiophen-2-ylbutanoylamino)oxan-4-yl]oxyacetic acid |
| SMILES | O=C(O)CO[C@H]1CCOC[C@H]1NC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C15H21NO5S/c17-14(5-1-3-11-4-2-8-22-11)16-12-9-20-7-6-13(12)21-10-15(18)19/h2,4,8,12-13H,1,3,5-7,9-10H2,(H,16,17)(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | LSMMZUFFQDNPQS-OLZOCXBDSA-N |
| XLogP | 1.45 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |