C15H24N2O4S2 — CID 135112135
N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-4-thiophen-2-ylbutanamide (PubChem CID 135112135) has the molecular formula C15H24N2O4S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 135112135 |
| Molecular Formula | C15H24N2O4S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-4-thiophen-2-ylbutanamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@H]1NC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C15H24N2O4S2/c1-17(2)23(19,20)11-12-9-21-10-14(12)16-15(18)7-3-5-13-6-4-8-22-13/h4,6,8,12,14H,3,5,7,9-11H2,1-2H3,(H,16,18)/t12-,14+/m0/s1 |
| InChIKey | JGHHDTXCOALPHH-GXTWGEPZSA-N |
| XLogP | 1.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |