C15H22ClNOS — CID 106366998
N-[2-(chloromethyl)cyclohexyl]-4-thiophen-2-ylbutanamide (PubChem CID 106366998) has the molecular formula C15H22ClNOS and a molecular weight of 299.87 g/mol. Its IUPAC name is N-[2-(chloromethyl)cyclohexyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[2-(chloromethyl)cyclohexyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 106366998 |
| Molecular Formula | C15H22ClNOS |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[2-(chloromethyl)cyclohexyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)NC1CCCCC1CCl |
| InChI | InChI=1S/C15H22ClNOS/c16-11-12-5-1-2-8-14(12)17-15(18)9-3-6-13-7-4-10-19-13/h4,7,10,12,14H,1-3,5-6,8-9,11H2,(H,17,18) |
| InChIKey | FFCXXKYUJNJGAF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|