C17H23NO6 — CID 91788296
2-[(3R,4S)-3-(4-phenoxybutanoylamino)oxan-4-yl]oxyacetic acid (PubChem CID 91788296) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[(3R,4S)-3-(4-phenoxybutanoylamino)oxan-4-yl]oxyacetic acid.
| Compound Name | 2-[(3R,4S)-3-(4-phenoxybutanoylamino)oxan-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 91788296 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[(3R,4S)-3-(4-phenoxybutanoylamino)oxan-4-yl]oxyacetic acid |
| SMILES | O=C(O)CO[C@H]1CCOC[C@H]1NC(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C17H23NO6/c19-16(7-4-9-23-13-5-2-1-3-6-13)18-14-11-22-10-8-15(14)24-12-17(20)21/h1-3,5-6,14-15H,4,7-12H2,(H,18,19)(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | DVVVGGJZDBCEIJ-CABCVRRESA-N |
| XLogP | 1.22 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|