C17H23NO5 — CID 91784519
2-[(3S,4R)-4-[3-(2-methylphenyl)propanoylamino]oxan-3-yl]oxyacetic acid (PubChem CID 91784519) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[(3S,4R)-4-[3-(2-methylphenyl)propanoylamino]oxan-3-yl]oxyacetic acid.
| Compound Name | 2-[(3S,4R)-4-[3-(2-methylphenyl)propanoylamino]oxan-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 91784519 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[(3S,4R)-4-[3-(2-methylphenyl)propanoylamino]oxan-3-yl]oxyacetic acid |
| SMILES | Cc1ccccc1CCC(=O)N[C@@H]1CCOC[C@H]1OCC(=O)O |
| InChI | InChI=1S/C17H23NO5/c1-12-4-2-3-5-13(12)6-7-16(19)18-14-8-9-22-10-15(14)23-11-17(20)21/h2-5,14-15H,6-11H2,1H3,(H,18,19)(H,20,21)/t14-,15-/m1/s1 |
| InChIKey | KIUDDYPCLJSLQO-HUUCEWRRSA-N |
| XLogP | 1.30 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |