C16H20N4O3 — CID 91765784
N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-2-(1,2,4-triazol-4-yl)acetamide (PubChem CID 91765784) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-2-(1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-2-(1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 91765784 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-2-(1,2,4-triazol-4-yl)acetamide |
| SMILES | O=C(Cn1cnnc1)N[C@@H]1COCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C16H20N4O3/c21-16(8-20-11-17-18-12-20)19-14-10-22-7-6-15(14)23-9-13-4-2-1-3-5-13/h1-5,11-12,14-15H,6-10H2,(H,19,21)/t14-,15+/m1/s1 |
| InChIKey | GTDNDCRKERFAOJ-CABCVRRESA-N |
| XLogP | 0.77 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |