C19H21ClN2O4 — CID 91784974
2-(4-chlorophenoxy)-N-[(3R,4S)-4-(pyridin-2-ylmethoxy)oxan-3-yl]acetamide (PubChem CID 91784974) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(3R,4S)-4-(pyridin-2-ylmethoxy)oxan-3-yl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(3R,4S)-4-(pyridin-2-ylmethoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 91784974 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(3R,4S)-4-(pyridin-2-ylmethoxy)oxan-3-yl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)N[C@@H]1COCC[C@@H]1OCc1ccccn1 |
| InChI | InChI=1S/C19H21ClN2O4/c20-14-4-6-16(7-5-14)25-13-19(23)22-17-12-24-10-8-18(17)26-11-15-3-1-2-9-21-15/h1-7,9,17-18H,8,10-13H2,(H,22,23)/t17-,18+/m1/s1 |
| InChIKey | XGCVKWNQUJWTJK-MSOLQXFVSA-N |
| XLogP | 2.60 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |