C19H22FN3O3 — CID 91764941
1-[(4-fluorophenyl)methyl]-3-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]urea (PubChem CID 91764941) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]urea |
|---|---|
| PubChem CID | 91764941 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]urea |
| SMILES | O=C(NCc1ccc(F)cc1)N[C@@H]1COCC[C@H]1OCc1ccccn1 |
| InChI | InChI=1S/C19H22FN3O3/c20-15-6-4-14(5-7-15)11-22-19(24)23-17-13-25-10-8-18(17)26-12-16-3-1-2-9-21-16/h1-7,9,17-18H,8,10-13H2,(H2,22,23,24)/t17-,18-/m1/s1 |
| InChIKey | HVEBYCPDXALFBF-QZTJIDSGSA-N |
| XLogP | 2.39 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |