C18H18F2N2O3 — CID 91771107
2,5-difluoro-N-[(3R,4S)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzamide (PubChem CID 91771107) has the molecular formula C18H18F2N2O3 and a molecular weight of 348.35 g/mol. Its IUPAC name is 2,5-difluoro-N-[(3R,4S)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzamide.
| Compound Name | 2,5-difluoro-N-[(3R,4S)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzamide |
|---|---|
| PubChem CID | 91771107 |
| Molecular Formula | C18H18F2N2O3 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2,5-difluoro-N-[(3R,4S)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1COCC[C@@H]1OCc1ccccn1)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H18F2N2O3/c19-12-4-5-15(20)14(9-12)18(23)22-16-11-24-8-6-17(16)25-10-13-3-1-2-7-21-13/h1-5,7,9,16-17H,6,8,10-11H2,(H,22,23)/t16-,17+/m1/s1 |
| InChIKey | ABGSOEKLZSZVTK-SJORKVTESA-N |
| XLogP | 2.46 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |