C19H25F2NO3 — CID 91767604
N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-3-(2,4-difluorophenyl)propanamide (PubChem CID 91767604) has the molecular formula C19H25F2NO3 and a molecular weight of 353.41 g/mol. Its IUPAC name is N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-3-(2,4-difluorophenyl)propanamide.
| Compound Name | N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-3-(2,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 91767604 |
| Molecular Formula | C19H25F2NO3 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-3-(2,4-difluorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(F)cc1F)N[C@@H]1CCOC[C@H]1OCC1CCC1 |
| InChI | InChI=1S/C19H25F2NO3/c20-15-6-4-14(16(21)10-15)5-7-19(23)22-17-8-9-24-12-18(17)25-11-13-2-1-3-13/h4,6,10,13,17-18H,1-3,5,7-9,11-12H2,(H,22,23)/t17-,18-/m1/s1 |
| InChIKey | DPOCQIZMIRALJJ-QZTJIDSGSA-N |
| XLogP | 2.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |