C17H22ClNO3S — CID 156608390
2-(4-chlorophenyl)sulfanyl-N-[3-(cyclopropylmethoxy)oxan-4-yl]acetamide (PubChem CID 156608390) has the molecular formula C17H22ClNO3S and a molecular weight of 355.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[3-(cyclopropylmethoxy)oxan-4-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[3-(cyclopropylmethoxy)oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 156608390 |
| Molecular Formula | C17H22ClNO3S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[3-(cyclopropylmethoxy)oxan-4-yl]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NC1CCOCC1OCC1CC1 |
| InChI | InChI=1S/C17H22ClNO3S/c18-13-3-5-14(6-4-13)23-11-17(20)19-15-7-8-21-10-16(15)22-9-12-1-2-12/h3-6,12,15-16H,1-2,7-11H2,(H,19,20) |
| InChIKey | AMTZBNRNSLONGH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |