C17H23ClF2N2O3 — CID 91784481
2-(3-chloro-2,6-difluorophenyl)-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]acetamide (PubChem CID 91784481) has the molecular formula C17H23ClF2N2O3 and a molecular weight of 376.83 g/mol. Its IUPAC name is 2-(3-chloro-2,6-difluorophenyl)-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]acetamide.
| Compound Name | 2-(3-chloro-2,6-difluorophenyl)-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 91784481 |
| Molecular Formula | C17H23ClF2N2O3 |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-(3-chloro-2,6-difluorophenyl)-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]acetamide |
| SMILES | CN(C)CCO[C@@H]1COCC[C@H]1NC(=O)Cc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C17H23ClF2N2O3/c1-22(2)6-8-25-15-10-24-7-5-14(15)21-16(23)9-11-13(19)4-3-12(18)17(11)20/h3-4,14-15H,5-10H2,1-2H3,(H,21,23)/t14-,15-/m1/s1 |
| InChIKey | ATOGAJZLTJRIBJ-HUUCEWRRSA-N |
| XLogP | 2.01 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|