C16H17FN2O3 — CID 91786162
N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-1H-pyrrole-3-carboxamide (PubChem CID 91786162) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 91786162 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]-1H-pyrrole-3-carboxamide |
| SMILES | O=C(N[C@@H]1COCC[C@@H]1Oc1cccc(F)c1)c1cc[nH]c1 |
| InChI | InChI=1S/C16H17FN2O3/c17-12-2-1-3-13(8-12)22-15-5-7-21-10-14(15)19-16(20)11-4-6-18-9-11/h1-4,6,8-9,14-15,18H,5,7,10H2,(H,19,20)/t14-,15+/m1/s1 |
| InChIKey | TUUGEDUEAOVFAU-CABCVRRESA-N |
| XLogP | 2.12 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |