C17H18FN3O3 — CID 91797334
6-amino-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]pyridine-3-carboxamide (PubChem CID 91797334) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is 6-amino-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]pyridine-3-carboxamide.
| Compound Name | 6-amino-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91797334 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 6-amino-N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]pyridine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)N[C@@H]2COCC[C@@H]2Oc2cccc(F)c2)cn1 |
| InChI | InChI=1S/C17H18FN3O3/c18-12-2-1-3-13(8-12)24-15-6-7-23-10-14(15)21-17(22)11-4-5-16(19)20-9-11/h1-5,8-9,14-15H,6-7,10H2,(H2,19,20)(H,21,22)/t14-,15+/m1/s1 |
| InChIKey | UCNUDRJEDAPYLS-CABCVRRESA-N |
| XLogP | 1.77 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |