C13H19N3O4 — CID 91769238
6-amino-N-[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]pyridine-3-carboxamide (PubChem CID 91769238) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 6-amino-N-[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]pyridine-3-carboxamide.
| Compound Name | 6-amino-N-[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91769238 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 6-amino-N-[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]pyridine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)N[C@@H]2COCC[C@@H]2OCCO)cn1 |
| InChI | InChI=1S/C13H19N3O4/c14-12-2-1-9(7-15-12)13(18)16-10-8-19-5-3-11(10)20-6-4-17/h1-2,7,10-11,17H,3-6,8H2,(H2,14,15)(H,16,18)/t10-,11+/m1/s1 |
| InChIKey | XIFGWBGZZLIKDI-MNOVXSKESA-N |
| XLogP | -0.44 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |