C18H23N3O4 — CID 91785949
N-[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]-3-(pyrazol-1-ylmethyl)benzamide (PubChem CID 91785949) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]-3-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]-3-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 91785949 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[(3R,4S)-4-(2-hydroxyethoxy)oxan-3-yl]-3-(pyrazol-1-ylmethyl)benzamide |
| SMILES | O=C(N[C@@H]1COCC[C@@H]1OCCO)c1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C18H23N3O4/c22-8-10-25-17-5-9-24-13-16(17)20-18(23)15-4-1-3-14(11-15)12-21-7-2-6-19-21/h1-4,6-7,11,16-17,22H,5,8-10,12-13H2,(H,20,23)/t16-,17+/m1/s1 |
| InChIKey | WILKICFRJJQMAM-SJORKVTESA-N |
| XLogP | 0.83 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |