C19H25NO5 — CID 156608304
N-[3-(2-hydroxyethoxy)oxan-4-yl]-3-(3-hydroxy-3-methylbut-1-ynyl)benzamide (PubChem CID 156608304) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[3-(2-hydroxyethoxy)oxan-4-yl]-3-(3-hydroxy-3-methylbut-1-ynyl)benzamide.
| Compound Name | N-[3-(2-hydroxyethoxy)oxan-4-yl]-3-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 156608304 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[3-(2-hydroxyethoxy)oxan-4-yl]-3-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
| SMILES | CC(C)(O)C#Cc1cccc(C(=O)NC2CCOCC2OCCO)c1 |
| InChI | InChI=1S/C19H25NO5/c1-19(2,23)8-6-14-4-3-5-15(12-14)18(22)20-16-7-10-24-13-17(16)25-11-9-21/h3-5,12,16-17,21,23H,7,9-11,13H2,1-2H3,(H,20,22) |
| InChIKey | IOVWOBNATMZLOQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|