C18H23F2NO4 — CID 91776698
3-(difluoromethoxy)-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]benzamide (PubChem CID 91776698) has the molecular formula C18H23F2NO4 and a molecular weight of 355.38 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 91776698 |
| Molecular Formula | C18H23F2NO4 |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-(difluoromethoxy)-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]benzamide |
| SMILES | CC(C)=CCO[C@@H]1COCC[C@H]1NC(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C18H23F2NO4/c1-12(2)6-9-24-16-11-23-8-7-15(16)21-17(22)13-4-3-5-14(10-13)25-18(19)20/h3-6,10,15-16,18H,7-9,11H2,1-2H3,(H,21,22)/t15-,16-/m1/s1 |
| InChIKey | GZOINGGEGTZHFQ-HZPDHXFCSA-N |
| XLogP | 3.16 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|