C16H23N3O3 — CID 91772333
4-methyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrimidine-5-carboxamide (PubChem CID 91772333) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-methyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrimidine-5-carboxamide.
| Compound Name | 4-methyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91772333 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 4-methyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrimidine-5-carboxamide |
| SMILES | CC(C)=CCO[C@@H]1COCC[C@H]1NC(=O)c1cncnc1C |
| InChI | InChI=1S/C16H23N3O3/c1-11(2)4-7-22-15-9-21-6-5-14(15)19-16(20)13-8-17-10-18-12(13)3/h4,8,10,14-15H,5-7,9H2,1-3H3,(H,19,20)/t14-,15-/m1/s1 |
| InChIKey | RIRBBHPDSKSKDE-HUUCEWRRSA-N |
| XLogP | 1.66 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|