C18H25N3O4 — CID 91772398
2-cyclopropyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 91772398) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-cyclopropyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91772398 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-cyclopropyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CC(C)=CCO[C@@H]1COCC[C@H]1NC(=O)c1cnc(C2CC2)[nH]c1=O |
| InChI | InChI=1S/C18H25N3O4/c1-11(2)5-8-25-15-10-24-7-6-14(15)20-17(22)13-9-19-16(12-3-4-12)21-18(13)23/h5,9,12,14-15H,3-4,6-8,10H2,1-2H3,(H,20,22)(H,19,21,23)/t14-,15-/m1/s1 |
| InChIKey | CMGTZEUMASNSQG-HUUCEWRRSA-N |
| XLogP | 1.52 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|