C17H26N2O4 — CID 91783225
N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-3-propan-2-yl-1,2-oxazole-5-carboxamide (PubChem CID 91783225) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-3-propan-2-yl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-3-propan-2-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91783225 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-3-propan-2-yl-1,2-oxazole-5-carboxamide |
| SMILES | CC(C)=CCO[C@@H]1COCC[C@H]1NC(=O)c1cc(C(C)C)no1 |
| InChI | InChI=1S/C17H26N2O4/c1-11(2)5-8-22-16-10-21-7-6-13(16)18-17(20)15-9-14(12(3)4)19-23-15/h5,9,12-13,16H,6-8,10H2,1-4H3,(H,18,20)/t13-,16-/m1/s1 |
| InChIKey | ZJEIVYPTNQHUFN-CZUORRHYSA-N |
| XLogP | 2.67 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|