C16H24N2O3 — CID 164634615
1-methyl-N-[(3R,4S)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrrole-2-carboxamide (PubChem CID 164634615) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-methyl-N-[(3R,4S)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-[(3R,4S)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 164634615 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-methyl-N-[(3R,4S)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrrole-2-carboxamide |
| SMILES | CC(C)=CCO[C@H]1COCC[C@@H]1NC(=O)c1cccn1C |
| InChI | InChI=1S/C16H24N2O3/c1-12(2)6-10-21-15-11-20-9-7-13(15)17-16(19)14-5-4-8-18(14)3/h4-6,8,13,15H,7,9-11H2,1-3H3,(H,17,19)/t13-,15-/m0/s1 |
| InChIKey | FOHOGRGUXOMPPB-ZFWWWQNUSA-N |
| XLogP | 1.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|