C16H29N3O3 — CID 91774051
4-methyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]piperazine-1-carboxamide (PubChem CID 91774051) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-methyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]piperazine-1-carboxamide.
| Compound Name | 4-methyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 91774051 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 4-methyl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]piperazine-1-carboxamide |
| SMILES | CC(C)=CCO[C@@H]1COCC[C@H]1NC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C16H29N3O3/c1-13(2)4-11-22-15-12-21-10-5-14(15)17-16(20)19-8-6-18(3)7-9-19/h4,14-15H,5-12H2,1-3H3,(H,17,20)/t14-,15-/m1/s1 |
| InChIKey | IVDIXFRLZJWNKA-HUUCEWRRSA-N |
| XLogP | 1.08 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|