C20H27N3O3 — CID 91794310
3-imidazo[1,2-a]pyridin-2-yl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]propanamide (PubChem CID 91794310) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-2-yl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]propanamide.
| Compound Name | 3-imidazo[1,2-a]pyridin-2-yl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]propanamide |
|---|---|
| PubChem CID | 91794310 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-2-yl-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]propanamide |
| SMILES | CC(C)=CCO[C@@H]1COCC[C@H]1NC(=O)CCc1cn2ccccc2n1 |
| InChI | InChI=1S/C20H27N3O3/c1-15(2)8-12-26-18-14-25-11-9-17(18)22-20(24)7-6-16-13-23-10-4-3-5-19(23)21-16/h3-5,8,10,13,17-18H,6-7,9,11-12,14H2,1-2H3,(H,22,24)/t17-,18-/m1/s1 |
| InChIKey | QTRLDNKLYHGFOA-QZTJIDSGSA-N |
| XLogP | 2.52 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|