C17H27N3O3 — CID 133267438
N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(3-methylpyrazol-1-yl)propanamide (PubChem CID 133267438) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(3-methylpyrazol-1-yl)propanamide.
| Compound Name | N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(3-methylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 133267438 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(3-methylpyrazol-1-yl)propanamide |
| SMILES | CC(C)=CCO[C@@H]1CCOC[C@@H]1NC(=O)CCn1ccc(C)n1 |
| InChI | InChI=1S/C17H27N3O3/c1-13(2)6-11-23-16-7-10-22-12-15(16)18-17(21)5-9-20-8-4-14(3)19-20/h4,6,8,15-16H,5,7,9-12H2,1-3H3,(H,18,21)/t15-,16+/m0/s1 |
| InChIKey | CKWYJNFRLKKPEW-JKSUJKDBSA-N |
| XLogP | 1.84 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|