C20H29NO5 — CID 91793943
2-(2,4-dimethoxyphenyl)-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide (PubChem CID 91793943) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 91793943 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide |
| SMILES | COc1ccc(CC(=O)N[C@@H]2COCC[C@@H]2OCC=C(C)C)c(OC)c1 |
| InChI | InChI=1S/C20H29NO5/c1-14(2)7-10-26-18-8-9-25-13-17(18)21-20(22)11-15-5-6-16(23-3)12-19(15)24-4/h5-7,12,17-18H,8-11,13H2,1-4H3,(H,21,22)/t17-,18+/m1/s1 |
| InChIKey | JATIZMVCXYWOTL-MSOLQXFVSA-N |
| XLogP | 2.50 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|