C20H27NO5 — CID 133268819
7-methyl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 133268819) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 7-methyl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | 7-methyl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 133268819 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 7-methyl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | CC(C)=CCO[C@@H]1CCOC[C@@H]1NC(=O)c1cc2c(cc1C)OCCO2 |
| InChI | InChI=1S/C20H27NO5/c1-13(2)4-7-24-17-5-6-23-12-16(17)21-20(22)15-11-19-18(10-14(15)3)25-8-9-26-19/h4,10-11,16-17H,5-9,12H2,1-3H3,(H,21,22)/t16-,17+/m0/s1 |
| InChIKey | OILWRWLVXKTDQB-DLBZAZTESA-N |
| XLogP | 2.64 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|