C20H30N2O4 — CID 91781826
6-ethyl-1,5-dimethyl-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-oxopyridine-3-carboxamide (PubChem CID 91781826) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 6-ethyl-1,5-dimethyl-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-oxopyridine-3-carboxamide.
| Compound Name | 6-ethyl-1,5-dimethyl-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 91781826 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 6-ethyl-1,5-dimethyl-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-oxopyridine-3-carboxamide |
| SMILES | CCc1c(C)cc(C(=O)N[C@@H]2COCC[C@@H]2OCC=C(C)C)c(=O)n1C |
| InChI | InChI=1S/C20H30N2O4/c1-6-17-14(4)11-15(20(24)22(17)5)19(23)21-16-12-25-9-8-18(16)26-10-7-13(2)3/h7,11,16,18H,6,8-10,12H2,1-5H3,(H,21,23)/t16-,18+/m1/s1 |
| InChIKey | KNSGZHXRQRSPKI-AEFFLSMTSA-N |
| XLogP | 2.13 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|