C20H23FN2O4 — CID 133267535
6-fluoro-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 133267535) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is 6-fluoro-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | 6-fluoro-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 133267535 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 6-fluoro-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CC(C)=CCO[C@@H]1CCOC[C@@H]1NC(=O)c1cc(=O)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C20H23FN2O4/c1-12(2)5-8-27-18-6-7-26-11-17(18)23-20(25)15-10-19(24)22-16-4-3-13(21)9-14(15)16/h3-5,9-10,17-18H,6-8,11H2,1-2H3,(H,22,24)(H,23,25)/t17-,18+/m0/s1 |
| InChIKey | WQHQKUMSCDGIJT-ZWKOTPCHSA-N |
| XLogP | 2.54 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|