C17H24N2O4 — CID 91787921
4-(hydroxymethyl)-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]pyridine-2-carboxamide (PubChem CID 91787921) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]pyridine-2-carboxamide.
| Compound Name | 4-(hydroxymethyl)-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91787921 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-(hydroxymethyl)-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]pyridine-2-carboxamide |
| SMILES | CC(C)=CCO[C@H]1CCOC[C@H]1NC(=O)c1cc(CO)ccn1 |
| InChI | InChI=1S/C17H24N2O4/c1-12(2)4-8-23-16-5-7-22-11-15(16)19-17(21)14-9-13(10-20)3-6-18-14/h3-4,6,9,15-16,20H,5,7-8,10-11H2,1-2H3,(H,19,21)/t15-,16+/m1/s1 |
| InChIKey | SUNNTIGTROILFV-CVEARBPZSA-N |
| XLogP | 1.44 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|