C19H24N2O4 — CID 133267850
2-methyl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-1,3-benzoxazole-6-carboxamide (PubChem CID 133267850) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-methyl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-1,3-benzoxazole-6-carboxamide.
| Compound Name | 2-methyl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 133267850 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-methyl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-1,3-benzoxazole-6-carboxamide |
| SMILES | CC(C)=CCO[C@@H]1CCOC[C@@H]1NC(=O)c1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C19H24N2O4/c1-12(2)6-9-24-17-7-8-23-11-16(17)21-19(22)14-4-5-15-18(10-14)25-13(3)20-15/h4-6,10,16-17H,7-9,11H2,1-3H3,(H,21,22)/t16-,17+/m0/s1 |
| InChIKey | QXGMGZQFUFYCRK-DLBZAZTESA-N |
| XLogP | 3.01 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|