C19H29N3O3 — CID 91793058
N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-[methyl(pyridin-4-ylmethyl)amino]acetamide (PubChem CID 91793058) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-[methyl(pyridin-4-ylmethyl)amino]acetamide.
| Compound Name | N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-[methyl(pyridin-4-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 91793058 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-[methyl(pyridin-4-ylmethyl)amino]acetamide |
| SMILES | CC(C)=CCO[C@H]1CCOC[C@H]1NC(=O)CN(C)Cc1ccncc1 |
| InChI | InChI=1S/C19H29N3O3/c1-15(2)6-11-25-18-7-10-24-14-17(18)21-19(23)13-22(3)12-16-4-8-20-9-5-16/h4-6,8-9,17-18H,7,10-14H2,1-3H3,(H,21,23)/t17-,18+/m1/s1 |
| InChIKey | NBGZQQJHULRFCV-MSOLQXFVSA-N |
| XLogP | 1.77 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|