C15H23N3O3 — CID 133266485
2-imidazol-1-yl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide (PubChem CID 133266485) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide.
| Compound Name | 2-imidazol-1-yl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 133266485 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-imidazol-1-yl-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide |
| SMILES | CC(C)=CCO[C@@H]1CCOC[C@@H]1NC(=O)Cn1ccnc1 |
| InChI | InChI=1S/C15H23N3O3/c1-12(2)3-8-21-14-4-7-20-10-13(14)17-15(19)9-18-6-5-16-11-18/h3,5-6,11,13-14H,4,7-10H2,1-2H3,(H,17,19)/t13-,14+/m0/s1 |
| InChIKey | XLLZUKWGWOSBHR-UONOGXRCSA-N |
| XLogP | 1.14 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|